C26H28O5S — CID 142713660
1-[(E)-2-[4-(3-benzylsulfonylpropoxy)phenyl]ethenyl]-3,5-dimethoxybenzene (PubChem CID 142713660) has the molecular formula C26H28O5S and a molecular weight of 452.57 g/mol. Its IUPAC name is 1-[(E)-2-[4-(3-benzylsulfonylpropoxy)phenyl]ethenyl]-3,5-dimethoxybenzene.
| Compound Name | 1-[(E)-2-[4-(3-benzylsulfonylpropoxy)phenyl]ethenyl]-3,5-dimethoxybenzene |
|---|---|
| PubChem CID | 142713660 |
| Molecular Formula | C26H28O5S |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 1-[(E)-2-[4-(3-benzylsulfonylpropoxy)phenyl]ethenyl]-3,5-dimethoxybenzene |
| SMILES | COc1cc(/C=C/c2ccc(OCCCS(=O)(=O)Cc3ccccc3)cc2)cc(OC)c1 |
| InChI | InChI=1S/C26H28O5S/c1-29-25-17-23(18-26(19-25)30-2)10-9-21-11-13-24(14-12-21)31-15-6-16-32(27,28)20-22-7-4-3-5-8-22/h3-5,7-14,17-19H,6,15-16,20H2,1-2H3/b10-9+ |
| InChIKey | LCRJYSUZYSNICC-MDZDMXLPSA-N |
| XLogP | 5.26 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|