C16H16IN5O4 — CID 142714137
9-[(3aS,4R,6aS)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-8-(furan-2-yl)-2-iodopurin-6-amine (PubChem CID 142714137) has the molecular formula C16H16IN5O4 and a molecular weight of 469.24 g/mol. Its IUPAC name is 9-[(3aS,4R,6aS)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-8-(furan-2-yl)-2-iodopurin-6-amine.
| Compound Name | 9-[(3aS,4R,6aS)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-8-(furan-2-yl)-2-iodopurin-6-amine |
|---|---|
| PubChem CID | 142714137 |
| Molecular Formula | C16H16IN5O4 |
| Molecular Weight | 469.24 g/mol |
| Exact Mass | 469.02 |
| IUPAC Name | 9-[(3aS,4R,6aS)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-8-(furan-2-yl)-2-iodopurin-6-amine |
| SMILES | CC1(C)O[C@H]2[C@H](CO[C@H]2n2c(-c3ccco3)nc3c(N)nc(I)nc32)O1 |
| InChI | InChI=1S/C16H16IN5O4/c1-16(2)25-8-6-24-14(10(8)26-16)22-12(7-4-3-5-23-7)19-9-11(18)20-15(17)21-13(9)22/h3-5,8,10,14H,6H2,1-2H3,(H2,18,20,21)/t8-,10-,14+/m0/s1 |
| InChIKey | DVGLPZGOWMGKLZ-QEVYDEPDSA-N |
| XLogP | 2.32 |
| TPSA | 110.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.24 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|