C23H26N2O2 — CID 14271435
ethyl 16-(tert-butyliminomethyl)-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaene-1-carboxylate (PubChem CID 14271435) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is ethyl 16-(tert-butyliminomethyl)-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaene-1-carboxylate.
| Compound Name | ethyl 16-(tert-butyliminomethyl)-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaene-1-carboxylate |
|---|---|
| PubChem CID | 14271435 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | ethyl 16-(tert-butyliminomethyl)-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaene-1-carboxylate |
| SMILES | CCOC(=O)C12c3ccccc3CC(c3ccccc31)N2/C=N/C(C)(C)C |
| InChI | InChI=1S/C23H26N2O2/c1-5-27-21(26)23-18-12-8-6-10-16(18)14-20(17-11-7-9-13-19(17)23)25(23)15-24-22(2,3)4/h6-13,15,20H,5,14H2,1-4H3/b24-15+ |
| InChIKey | JXQWSMKMIOGGPD-BUVRLJJBSA-N |
| XLogP | 4.23 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|