C8H13F4O3P — CID 142714949
5,5-dimethyl-2-(2,2,3,3-tetrafluoropropoxy)-1,3,2-dioxaphosphinane (PubChem CID 142714949) has the molecular formula C8H13F4O3P and a molecular weight of 264.15 g/mol. Its IUPAC name is 5,5-dimethyl-2-(2,2,3,3-tetrafluoropropoxy)-1,3,2-dioxaphosphinane.
| Compound Name | 5,5-dimethyl-2-(2,2,3,3-tetrafluoropropoxy)-1,3,2-dioxaphosphinane |
|---|---|
| PubChem CID | 142714949 |
| Molecular Formula | C8H13F4O3P |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 5,5-dimethyl-2-(2,2,3,3-tetrafluoropropoxy)-1,3,2-dioxaphosphinane |
| SMILES | CC1(C)COP(OCC(F)(F)C(F)F)OC1 |
| InChI | InChI=1S/C8H13F4O3P/c1-7(2)3-13-16(14-4-7)15-5-8(11,12)6(9)10/h6H,3-5H2,1-2H3 |
| InChIKey | GCHVRHGOAOTEHR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|