C14H23N5S — CID 142715263
N-butyl-1-tert-butyl-6-methylsulfanylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 142715263) has the molecular formula C14H23N5S and a molecular weight of 293.44 g/mol. Its IUPAC name is N-butyl-1-tert-butyl-6-methylsulfanylpyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | N-butyl-1-tert-butyl-6-methylsulfanylpyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 142715263 |
| Molecular Formula | C14H23N5S |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | N-butyl-1-tert-butyl-6-methylsulfanylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CCCCNc1nc(SC)nc2c1cnn2C(C)(C)C |
| InChI | InChI=1S/C14H23N5S/c1-6-7-8-15-11-10-9-16-19(14(2,3)4)12(10)18-13(17-11)20-5/h9H,6-8H2,1-5H3,(H,15,17,18) |
| InChIKey | PXAOBHBEDPZQTQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|