C20H15ClF3N3O2 — CID 142715561
[2-[3-[(2-chlorophenyl)methoxy]-2-pyridinyl]-4-(trifluoromethyl)phenyl]urea (PubChem CID 142715561) has the molecular formula C20H15ClF3N3O2 and a molecular weight of 421.81 g/mol. Its IUPAC name is [2-[3-[(2-chlorophenyl)methoxy]-2-pyridinyl]-4-(trifluoromethyl)phenyl]urea.
| Compound Name | [2-[3-[(2-chlorophenyl)methoxy]-2-pyridinyl]-4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 142715561 |
| Molecular Formula | C20H15ClF3N3O2 |
| Molecular Weight | 421.81 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | [2-[3-[(2-chlorophenyl)methoxy]-2-pyridinyl]-4-(trifluoromethyl)phenyl]urea |
| SMILES | NC(=O)Nc1ccc(C(F)(F)F)cc1-c1ncccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C20H15ClF3N3O2/c21-15-5-2-1-4-12(15)11-29-17-6-3-9-26-18(17)14-10-13(20(22,23)24)7-8-16(14)27-19(25)28/h1-10H,11H2,(H3,25,27,28) |
| InChIKey | TZSIBTABEJWGKE-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.81 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |