C20H28N4O2 — CID 142715624
1-(3-phenylmethoxypyrazin-2-yl)-3-(2,4,4-trimethylpentan-2-yl)urea (PubChem CID 142715624) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 1-(3-phenylmethoxypyrazin-2-yl)-3-(2,4,4-trimethylpentan-2-yl)urea.
| Compound Name | 1-(3-phenylmethoxypyrazin-2-yl)-3-(2,4,4-trimethylpentan-2-yl)urea |
|---|---|
| PubChem CID | 142715624 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 1-(3-phenylmethoxypyrazin-2-yl)-3-(2,4,4-trimethylpentan-2-yl)urea |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)Nc1nccnc1OCc1ccccc1 |
| InChI | InChI=1S/C20H28N4O2/c1-19(2,3)14-20(4,5)24-18(25)23-16-17(22-12-11-21-16)26-13-15-9-7-6-8-10-15/h6-12H,13-14H2,1-5H3,(H2,21,23,24,25) |
| InChIKey | AJJJDZLWEJCOQY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |