About 3-(2H-1,2-benzoxazin-3-yl)propyl-methoxy-methyl-propylsilane
3-(2H-1,2-benzoxazin-3-yl)propyl-methoxy-methyl-propylsilane (PubChem CID 142715697) has the molecular formula C16H25NO2Si
and a molecular weight of 291.47 g/mol. Its IUPAC name is 3-(2H-1,2-benzoxazin-3-yl)propyl-methoxy-methyl-propylsilane.
Molecular Properties
| Compound Name | 3-(2H-1,2-benzoxazin-3-yl)propyl-methoxy-methyl-propylsilane |
| PubChem CID | 142715697 |
| Molecular Formula | C16H25NO2Si |
| Molecular Weight | 291.47 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 3-(2H-1,2-benzoxazin-3-yl)propyl-methoxy-methyl-propylsilane |
| SMILES | CCC[Si](C)(CCCC1=Cc2ccccc2ON1)OC |
| InChI | InChI=1S/C16H25NO2Si/c1-4-11-20(3,18-2)12-7-9-15-13-14-8-5-6-10-16(14)19-17-15/h5-6,8,10,13,17H,4,7,9,11-12H2,1-3H3 |
| InChIKey | DJAPGUDIQUCBEZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-(2H-1,2-benzoxazin-3-yl)propyl-methoxy-methyl-propylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2H-1,2-benzoxazin-3-yl)propyl-methoxy-methyl-propylsilane?
The IUPAC name of 3-(2H-1,2-benzoxazin-3-yl)propyl-methoxy-methyl-propylsilane (CID 142715697) is 3-(2H-1,2-benzoxazin-3-yl)propyl-methoxy-methyl-propylsilane.
What is the SMILES notation for 3-(2H-1,2-benzoxazin-3-yl)propyl-methoxy-methyl-propylsilane?
The canonical SMILES for 3-(2H-1,2-benzoxazin-3-yl)propyl-methoxy-methyl-propylsilane is CCC[Si](C)(CCCC1=Cc2ccccc2ON1)OC.
What is the InChIKey of 3-(2H-1,2-benzoxazin-3-yl)propyl-methoxy-methyl-propylsilane?
The InChIKey is DJAPGUDIQUCBEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO2Si/c1-4-11-20(3,18-2)12-7-9-15-13-14-8-5-6-10-16(14)19-17-15/h5-6,8,10,13,17H,4,7,9,11-12H2,1-3H3.
What are the key properties of 3-(2H-1,2-benzoxazin-3-yl)propyl-methoxy-methyl-propylsilane?
3-(2H-1,2-benzoxazin-3-yl)propyl-methoxy-methyl-propylsilane has a molecular weight of 291.47 g/mol, XLogP of 4.34, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2H-1,2-benzoxazin-3-yl)propyl-methoxy-methyl-propylsilane is sourced from PubChem (CID 142715697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).