About 10-phenyl-3,7-dithiophen-2-ylphenothiazine
10-phenyl-3,7-dithiophen-2-ylphenothiazine (PubChem CID 142715732) has the molecular formula C26H17NS3
and a molecular weight of 439.63 g/mol. Its IUPAC name is 10-phenyl-3,7-dithiophen-2-ylphenothiazine.
Molecular Properties
| Compound Name | 10-phenyl-3,7-dithiophen-2-ylphenothiazine |
| PubChem CID | 142715732 |
| Molecular Formula | C26H17NS3 |
| Molecular Weight | 439.63 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | 10-phenyl-3,7-dithiophen-2-ylphenothiazine |
| SMILES | c1ccc(N2c3ccc(-c4cccs4)cc3Sc3cc(-c4cccs4)ccc32)cc1 |
| InChI | InChI=1S/C26H17NS3/c1-2-6-20(7-3-1)27-21-12-10-18(23-8-4-14-28-23)16-25(21)30-26-17-19(11-13-22(26)27)24-9-5-15-29-24/h1-17H |
| InChIKey | JFPQUQHGIRBGJY-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.63 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 10-phenyl-3,7-dithiophen-2-ylphenothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-phenyl-3,7-dithiophen-2-ylphenothiazine?
The IUPAC name of 10-phenyl-3,7-dithiophen-2-ylphenothiazine (CID 142715732) is 10-phenyl-3,7-dithiophen-2-ylphenothiazine.
What is the SMILES notation for 10-phenyl-3,7-dithiophen-2-ylphenothiazine?
The canonical SMILES for 10-phenyl-3,7-dithiophen-2-ylphenothiazine is c1ccc(N2c3ccc(-c4cccs4)cc3Sc3cc(-c4cccs4)ccc32)cc1.
What is the InChIKey of 10-phenyl-3,7-dithiophen-2-ylphenothiazine?
The InChIKey is JFPQUQHGIRBGJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H17NS3/c1-2-6-20(7-3-1)27-21-12-10-18(23-8-4-14-28-23)16-25(21)30-26-17-19(11-13-22(26)27)24-9-5-15-29-24/h1-17H.
What are the key properties of 10-phenyl-3,7-dithiophen-2-ylphenothiazine?
10-phenyl-3,7-dithiophen-2-ylphenothiazine has a molecular weight of 439.63 g/mol, XLogP of 9.08, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-phenyl-3,7-dithiophen-2-ylphenothiazine is sourced from PubChem (CID 142715732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).