C21H9F16NO3S — CID 142715805
[[1-(9H-fluoren-1-yl)-2,2,3,3,4,4,4-heptafluorobutylidene]amino] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 142715805) has the molecular formula C21H9F16NO3S and a molecular weight of 659.34 g/mol. Its IUPAC name is [[1-(9H-fluoren-1-yl)-2,2,3,3,4,4,4-heptafluorobutylidene]amino] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [[1-(9H-fluoren-1-yl)-2,2,3,3,4,4,4-heptafluorobutylidene]amino] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 142715805 |
| Molecular Formula | C21H9F16NO3S |
| Molecular Weight | 659.34 g/mol |
| Exact Mass | 659.00 |
| IUPAC Name | [[1-(9H-fluoren-1-yl)-2,2,3,3,4,4,4-heptafluorobutylidene]amino] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | O=S(=O)(ON=C(c1cccc2c1Cc1ccccc1-2)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H9F16NO3S/c22-15(23,16(24,25)19(30,31)32)14(12-7-3-6-11-10-5-2-1-4-9(10)8-13(11)12)38-41-42(39,40)21(36,37)18(28,29)17(26,27)20(33,34)35/h1-7H,8H2 |
| InChIKey | LIHWXKCQJFWOFX-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.34 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|