About azanium 2-[3-(fluoromethyl)-3,6-dihydro-2H-1,4-oxazin-5-yl]acetate
azanium 2-[3-(fluoromethyl)-3,6-dihydro-2H-1,4-oxazin-5-yl]acetate (PubChem CID 142715817) has the molecular formula C7H13FN2O3
and a molecular weight of 192.19 g/mol. Its IUPAC name is azanium 2-[3-(fluoromethyl)-3,6-dihydro-2H-1,4-oxazin-5-yl]acetate.
Molecular Properties
| Compound Name | azanium 2-[3-(fluoromethyl)-3,6-dihydro-2H-1,4-oxazin-5-yl]acetate |
| PubChem CID | 142715817 |
| Molecular Formula | C7H13FN2O3 |
| Molecular Weight | 192.19 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | azanium 2-[3-(fluoromethyl)-3,6-dihydro-2H-1,4-oxazin-5-yl]acetate |
| SMILES | O=C([O-])CC1=NC(CF)COC1.[NH4+] |
| InChI | InChI=1S/C7H10FNO3.H3N/c8-2-6-4-12-3-5(9-6)1-7(10)11;/h6H,1-4H2,(H,10,11);1H3 |
| InChIKey | QXKUECWUKXTFRE-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.19 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azanium 2-[3-(fluoromethyl)-3,6-dihydro-2H-1,4-oxazin-5-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium 2-[3-(fluoromethyl)-3,6-dihydro-2H-1,4-oxazin-5-yl]acetate?
The IUPAC name of azanium 2-[3-(fluoromethyl)-3,6-dihydro-2H-1,4-oxazin-5-yl]acetate (CID 142715817) is azanium 2-[3-(fluoromethyl)-3,6-dihydro-2H-1,4-oxazin-5-yl]acetate.
What is the SMILES notation for azanium 2-[3-(fluoromethyl)-3,6-dihydro-2H-1,4-oxazin-5-yl]acetate?
The canonical SMILES for azanium 2-[3-(fluoromethyl)-3,6-dihydro-2H-1,4-oxazin-5-yl]acetate is O=C([O-])CC1=NC(CF)COC1.[NH4+].
What is the InChIKey of azanium 2-[3-(fluoromethyl)-3,6-dihydro-2H-1,4-oxazin-5-yl]acetate?
The InChIKey is QXKUECWUKXTFRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10FNO3.H3N/c8-2-6-4-12-3-5(9-6)1-7(10)11;/h6H,1-4H2,(H,10,11);1H3.
What are the key properties of azanium 2-[3-(fluoromethyl)-3,6-dihydro-2H-1,4-oxazin-5-yl]acetate?
azanium 2-[3-(fluoromethyl)-3,6-dihydro-2H-1,4-oxazin-5-yl]acetate has a molecular weight of 192.19 g/mol, XLogP of -0.69, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azanium 2-[3-(fluoromethyl)-3,6-dihydro-2H-1,4-oxazin-5-yl]acetate is sourced from PubChem (CID 142715817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).