C32H35ClN2O5 — CID 142715845
tert-butyl 4-[3-[4-[5-(4-chlorophenoxy)-1-benzofuran-2-yl]phenoxy]propyl]piperazine-1-carboxylate (PubChem CID 142715845) has the molecular formula C32H35ClN2O5 and a molecular weight of 563.09 g/mol. Its IUPAC name is tert-butyl 4-[3-[4-[5-(4-chlorophenoxy)-1-benzofuran-2-yl]phenoxy]propyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[4-[5-(4-chlorophenoxy)-1-benzofuran-2-yl]phenoxy]propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 142715845 |
| Molecular Formula | C32H35ClN2O5 |
| Molecular Weight | 563.09 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | tert-butyl 4-[3-[4-[5-(4-chlorophenoxy)-1-benzofuran-2-yl]phenoxy]propyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCCOc2ccc(-c3cc4cc(Oc5ccc(Cl)cc5)ccc4o3)cc2)CC1 |
| InChI | InChI=1S/C32H35ClN2O5/c1-32(2,3)40-31(36)35-18-16-34(17-19-35)15-4-20-37-26-9-5-23(6-10-26)30-22-24-21-28(13-14-29(24)39-30)38-27-11-7-25(33)8-12-27/h5-14,21-22H,4,15-20H2,1-3H3 |
| InChIKey | ZBBUPGFJVRQNDE-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 64.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.09 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|