C11H21N2P — CID 142717009
1-N,1-N,4-N,4-N,3-pentamethyl-3-phosphanylcyclohexa-1,5-diene-1,4-diamine (PubChem CID 142717009) has the molecular formula C11H21N2P and a molecular weight of 212.28 g/mol. Its IUPAC name is 1-N,1-N,4-N,4-N,3-pentamethyl-3-phosphanylcyclohexa-1,5-diene-1,4-diamine.
| Compound Name | 1-N,1-N,4-N,4-N,3-pentamethyl-3-phosphanylcyclohexa-1,5-diene-1,4-diamine |
|---|---|
| PubChem CID | 142717009 |
| Molecular Formula | C11H21N2P |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 1-N,1-N,4-N,4-N,3-pentamethyl-3-phosphanylcyclohexa-1,5-diene-1,4-diamine |
| SMILES | CN(C)C1=CC(C)(P)C(N(C)C)C=C1 |
| InChI | InChI=1S/C11H21N2P/c1-11(14)8-9(12(2)3)6-7-10(11)13(4)5/h6-8,10H,14H2,1-5H3 |
| InChIKey | OOKZKDYFNFVUHY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|