C10H17NO2 — CID 14271710
4-propan-2-yl-4,4a,5,6,7,7a-hexahydro-3H-cyclopenta[e][1,3]oxazin-2-one (PubChem CID 14271710) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 4-propan-2-yl-4,4a,5,6,7,7a-hexahydro-3H-cyclopenta[e][1,3]oxazin-2-one.
| Compound Name | 4-propan-2-yl-4,4a,5,6,7,7a-hexahydro-3H-cyclopenta[e][1,3]oxazin-2-one |
|---|---|
| PubChem CID | 14271710 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 4-propan-2-yl-4,4a,5,6,7,7a-hexahydro-3H-cyclopenta[e][1,3]oxazin-2-one |
| SMILES | CC(C)C1NC(=O)OC2CCCC21 |
| InChI | InChI=1S/C10H17NO2/c1-6(2)9-7-4-3-5-8(7)13-10(12)11-9/h6-9H,3-5H2,1-2H3,(H,11,12) |
| InChIKey | DVIPCEJNXQTQLH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |