C12H10F3N5O3 — CID 142717238
[5-(5-azido-2-fluorophenyl)-5-(difluoromethyl)-2,6-dihydro-1,4-oxazin-3-yl]carbamic acid (PubChem CID 142717238) has the molecular formula C12H10F3N5O3 and a molecular weight of 329.24 g/mol. Its IUPAC name is [5-(5-azido-2-fluorophenyl)-5-(difluoromethyl)-2,6-dihydro-1,4-oxazin-3-yl]carbamic acid.
| Compound Name | [5-(5-azido-2-fluorophenyl)-5-(difluoromethyl)-2,6-dihydro-1,4-oxazin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 142717238 |
| Molecular Formula | C12H10F3N5O3 |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | [5-(5-azido-2-fluorophenyl)-5-(difluoromethyl)-2,6-dihydro-1,4-oxazin-3-yl]carbamic acid |
| SMILES | [N-]=[N+]=Nc1ccc(F)c(C2(C(F)F)COCC(NC(=O)O)=N2)c1 |
| InChI | InChI=1S/C12H10F3N5O3/c13-8-2-1-6(19-20-16)3-7(8)12(10(14)15)5-23-4-9(18-12)17-11(21)22/h1-3,10H,4-5H2,(H,17,18)(H,21,22) |
| InChIKey | YRBJDDPRSIIAKY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 119.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|