C18H26O2 — CID 142717250
(1S,2R,3aS,6aS)-1-[(3S,4S)-3-hydroxy-4-methylnona-1,6-diynyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol (PubChem CID 142717250) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is (1S,2R,3aS,6aS)-1-[(3S,4S)-3-hydroxy-4-methylnona-1,6-diynyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol.
| Compound Name | (1S,2R,3aS,6aS)-1-[(3S,4S)-3-hydroxy-4-methylnona-1,6-diynyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol |
|---|---|
| PubChem CID | 142717250 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | (1S,2R,3aS,6aS)-1-[(3S,4S)-3-hydroxy-4-methylnona-1,6-diynyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol |
| SMILES | CCC#CC[C@H](C)[C@H](O)C#C[C@@H]1[C@H]2CCC[C@H]2C[C@H]1O |
| InChI | InChI=1S/C18H26O2/c1-3-4-5-7-13(2)17(19)11-10-16-15-9-6-8-14(15)12-18(16)20/h13-20H,3,6-9,12H2,1-2H3/t13-,14-,15-,16+,17+,18+/m0/s1 |
| InChIKey | OAMGOKVZGJZKKB-SJUNHDGSSA-N |
| XLogP | 2.59 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|