C21H23NO4S — CID 142718705
ethyl 2-[4-(cyclopropylsulfonylamino)phenyl]-3-phenylcyclopropane-1-carboxylate (PubChem CID 142718705) has the molecular formula C21H23NO4S and a molecular weight of 385.49 g/mol. Its IUPAC name is ethyl 2-[4-(cyclopropylsulfonylamino)phenyl]-3-phenylcyclopropane-1-carboxylate.
| Compound Name | ethyl 2-[4-(cyclopropylsulfonylamino)phenyl]-3-phenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 142718705 |
| Molecular Formula | C21H23NO4S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | ethyl 2-[4-(cyclopropylsulfonylamino)phenyl]-3-phenylcyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1C(c2ccccc2)C1c1ccc(NS(=O)(=O)C2CC2)cc1 |
| InChI | InChI=1S/C21H23NO4S/c1-2-26-21(23)20-18(14-6-4-3-5-7-14)19(20)15-8-10-16(11-9-15)22-27(24,25)17-12-13-17/h3-11,17-20,22H,2,12-13H2,1H3 |
| InChIKey | XQWVZSDDBMXPKF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |