C21H30ClN5O2 — CID 142718995
5-[1-(3-methoxypropyl)piperidin-4-yl]-3-(3-propan-2-ylindazol-1-yl)-1,2,4-oxadiazole;hydrochloride (PubChem CID 142718995) has the molecular formula C21H30ClN5O2 and a molecular weight of 419.96 g/mol. Its IUPAC name is 5-[1-(3-methoxypropyl)piperidin-4-yl]-3-(3-propan-2-ylindazol-1-yl)-1,2,4-oxadiazole;hydrochloride.
| Compound Name | 5-[1-(3-methoxypropyl)piperidin-4-yl]-3-(3-propan-2-ylindazol-1-yl)-1,2,4-oxadiazole;hydrochloride |
|---|---|
| PubChem CID | 142718995 |
| Molecular Formula | C21H30ClN5O2 |
| Molecular Weight | 419.96 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 5-[1-(3-methoxypropyl)piperidin-4-yl]-3-(3-propan-2-ylindazol-1-yl)-1,2,4-oxadiazole;hydrochloride |
| SMILES | COCCCN1CCC(c2nc(-n3nc(C(C)C)c4ccccc43)no2)CC1.Cl |
| InChI | InChI=1S/C21H29N5O2.ClH/c1-15(2)19-17-7-4-5-8-18(17)26(23-19)21-22-20(28-24-21)16-9-12-25(13-10-16)11-6-14-27-3;/h4-5,7-8,15-16H,6,9-14H2,1-3H3;1H |
| InChIKey | GCBURNDKPWXYMO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 69.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.96 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|