C19H12F3N5O — CID 142719718
5-pyridin-3-yl-1-[4-(trifluoromethyl)-3-pyridinyl]indazole-3-carboxamide (PubChem CID 142719718) has the molecular formula C19H12F3N5O and a molecular weight of 383.33 g/mol. Its IUPAC name is 5-pyridin-3-yl-1-[4-(trifluoromethyl)-3-pyridinyl]indazole-3-carboxamide.
| Compound Name | 5-pyridin-3-yl-1-[4-(trifluoromethyl)-3-pyridinyl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 142719718 |
| Molecular Formula | C19H12F3N5O |
| Molecular Weight | 383.33 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 5-pyridin-3-yl-1-[4-(trifluoromethyl)-3-pyridinyl]indazole-3-carboxamide |
| SMILES | NC(=O)c1nn(-c2cnccc2C(F)(F)F)c2ccc(-c3cccnc3)cc12 |
| InChI | InChI=1S/C19H12F3N5O/c20-19(21,22)14-5-7-25-10-16(14)27-15-4-3-11(12-2-1-6-24-9-12)8-13(15)17(26-27)18(23)28/h1-10H,(H2,23,28) |
| InChIKey | CHKSWNYDCWMLHL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |