About azane;naphthalen-1-amine;dihydrochloride
azane;naphthalen-1-amine;dihydrochloride (PubChem CID 142719941) has the molecular formula C10H14Cl2N2
and a molecular weight of 233.14 g/mol. Its IUPAC name is azane;naphthalen-1-amine;dihydrochloride.
Molecular Properties
| Compound Name | azane;naphthalen-1-amine;dihydrochloride |
| PubChem CID | 142719941 |
| Molecular Formula | C10H14Cl2N2 |
| Molecular Weight | 233.14 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | azane;naphthalen-1-amine;dihydrochloride |
| SMILES | Cl.Cl.N.Nc1cccc2ccccc12 |
| InChI | InChI=1S/C10H9N.2ClH.H3N/c11-10-7-3-5-8-4-1-2-6-9(8)10;;;/h1-7H,11H2;2*1H;1H3 |
| InChIKey | LDCFVLNUSWFVQQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.14 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze azane;naphthalen-1-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;naphthalen-1-amine;dihydrochloride?
The IUPAC name of azane;naphthalen-1-amine;dihydrochloride (CID 142719941) is azane;naphthalen-1-amine;dihydrochloride.
What is the SMILES notation for azane;naphthalen-1-amine;dihydrochloride?
The canonical SMILES for azane;naphthalen-1-amine;dihydrochloride is Cl.Cl.N.Nc1cccc2ccccc12.
What is the InChIKey of azane;naphthalen-1-amine;dihydrochloride?
The InChIKey is LDCFVLNUSWFVQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N.2ClH.H3N/c11-10-7-3-5-8-4-1-2-6-9(8)10;;;/h1-7H,11H2;2*1H;1H3.
What are the key properties of azane;naphthalen-1-amine;dihydrochloride?
azane;naphthalen-1-amine;dihydrochloride has a molecular weight of 233.14 g/mol, XLogP of 3.43, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;naphthalen-1-amine;dihydrochloride is sourced from PubChem (CID 142719941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).