C36H34ClN3O3 — CID 142720901
4-[[5-(4-chlorophenoxy)-3-[4-[3-(diethylamino)propoxy]benzoyl]indol-1-yl]methyl]benzonitrile (PubChem CID 142720901) has the molecular formula C36H34ClN3O3 and a molecular weight of 592.14 g/mol. Its IUPAC name is 4-[[5-(4-chlorophenoxy)-3-[4-[3-(diethylamino)propoxy]benzoyl]indol-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[5-(4-chlorophenoxy)-3-[4-[3-(diethylamino)propoxy]benzoyl]indol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 142720901 |
| Molecular Formula | C36H34ClN3O3 |
| Molecular Weight | 592.14 g/mol |
| Exact Mass | 591.23 |
| IUPAC Name | 4-[[5-(4-chlorophenoxy)-3-[4-[3-(diethylamino)propoxy]benzoyl]indol-1-yl]methyl]benzonitrile |
| SMILES | CCN(CC)CCCOc1ccc(C(=O)c2cn(Cc3ccc(C#N)cc3)c3ccc(Oc4ccc(Cl)cc4)cc23)cc1 |
| InChI | InChI=1S/C36H34ClN3O3/c1-3-39(4-2)20-5-21-42-30-14-10-28(11-15-30)36(41)34-25-40(24-27-8-6-26(23-38)7-9-27)35-19-18-32(22-33(34)35)43-31-16-12-29(37)13-17-31/h6-19,22,25H,3-5,20-21,24H2,1-2H3 |
| InChIKey | WWZUGCJRCUIUKP-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 67.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.14 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|