About 2-chloro-3-(4,4-dimethoxybutylamino)naphthalene-1,4-dione
2-chloro-3-(4,4-dimethoxybutylamino)naphthalene-1,4-dione (PubChem CID 142721278) has the molecular formula C16H18ClNO4
and a molecular weight of 323.78 g/mol. Its IUPAC name is 2-chloro-3-(4,4-dimethoxybutylamino)naphthalene-1,4-dione.
Molecular Properties
| Compound Name | 2-chloro-3-(4,4-dimethoxybutylamino)naphthalene-1,4-dione |
| PubChem CID | 142721278 |
| Molecular Formula | C16H18ClNO4 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 2-chloro-3-(4,4-dimethoxybutylamino)naphthalene-1,4-dione |
| SMILES | COC(CCCNC1=C(Cl)C(=O)c2ccccc2C1=O)OC |
| InChI | InChI=1S/C16H18ClNO4/c1-21-12(22-2)8-5-9-18-14-13(17)15(19)10-6-3-4-7-11(10)16(14)20/h3-4,6-7,12,18H,5,8-9H2,1-2H3 |
| InChIKey | UHVKHKXSNGNDCO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-(4,4-dimethoxybutylamino)naphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-(4,4-dimethoxybutylamino)naphthalene-1,4-dione?
The IUPAC name of 2-chloro-3-(4,4-dimethoxybutylamino)naphthalene-1,4-dione (CID 142721278) is 2-chloro-3-(4,4-dimethoxybutylamino)naphthalene-1,4-dione.
What is the SMILES notation for 2-chloro-3-(4,4-dimethoxybutylamino)naphthalene-1,4-dione?
The canonical SMILES for 2-chloro-3-(4,4-dimethoxybutylamino)naphthalene-1,4-dione is COC(CCCNC1=C(Cl)C(=O)c2ccccc2C1=O)OC.
What is the InChIKey of 2-chloro-3-(4,4-dimethoxybutylamino)naphthalene-1,4-dione?
The InChIKey is UHVKHKXSNGNDCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18ClNO4/c1-21-12(22-2)8-5-9-18-14-13(17)15(19)10-6-3-4-7-11(10)16(14)20/h3-4,6-7,12,18H,5,8-9H2,1-2H3.
What are the key properties of 2-chloro-3-(4,4-dimethoxybutylamino)naphthalene-1,4-dione?
2-chloro-3-(4,4-dimethoxybutylamino)naphthalene-1,4-dione has a molecular weight of 323.78 g/mol, XLogP of 2.50, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-(4,4-dimethoxybutylamino)naphthalene-1,4-dione is sourced from PubChem (CID 142721278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).