C19H29ClO2Si — CID 142722109
ditert-butyl-[2-(5-chloropent-1-ynyl)phenoxy]-hydroxysilane (PubChem CID 142722109) has the molecular formula C19H29ClO2Si and a molecular weight of 352.98 g/mol. Its IUPAC name is ditert-butyl-[2-(5-chloropent-1-ynyl)phenoxy]-hydroxysilane.
| Compound Name | ditert-butyl-[2-(5-chloropent-1-ynyl)phenoxy]-hydroxysilane |
|---|---|
| PubChem CID | 142722109 |
| Molecular Formula | C19H29ClO2Si |
| Molecular Weight | 352.98 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | ditert-butyl-[2-(5-chloropent-1-ynyl)phenoxy]-hydroxysilane |
| SMILES | CC(C)(C)[Si](O)(Oc1ccccc1C#CCCCCl)C(C)(C)C |
| InChI | InChI=1S/C19H29ClO2Si/c1-18(2,3)23(21,19(4,5)6)22-17-14-10-9-13-16(17)12-8-7-11-15-20/h9-10,13-14,21H,7,11,15H2,1-6H3 |
| InChIKey | AHNNUKDVFOVRHE-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.98 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|