About tert-butyl (2S)-2-(1λ3-ioda-2,4-diazacyclopenta-2,5-dien-3-yl)pyrrolidine-1-carboxylate
tert-butyl (2S)-2-(1λ3-ioda-2,4-diazacyclopenta-2,5-dien-3-yl)pyrrolidine-1-carboxylate (PubChem CID 142722129) has the molecular formula C11H18IN3O2
and a molecular weight of 351.19 g/mol. Its IUPAC name is tert-butyl (2S)-2-(1λ3-ioda-2,4-diazacyclopenta-2,5-dien-3-yl)pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2S)-2-(1λ3-ioda-2,4-diazacyclopenta-2,5-dien-3-yl)pyrrolidine-1-carboxylate |
| PubChem CID | 142722129 |
| Molecular Formula | C11H18IN3O2 |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | tert-butyl (2S)-2-(1λ3-ioda-2,4-diazacyclopenta-2,5-dien-3-yl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C1=NI=CN1 |
| InChI | InChI=1S/C11H18IN3O2/c1-11(2,3)17-10(16)15-6-4-5-8(15)9-13-7-12-14-9/h7-8H,4-6H2,1-3H3,(H,13,14)/t8-/m0/s1 |
| InChIKey | QQNSLJULOPRVJF-QMMMGPOBSA-N |
| XLogP | 2.03 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (2S)-2-(1λ3-ioda-2,4-diazacyclopenta-2,5-dien-3-yl)pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S)-2-(1λ3-ioda-2,4-diazacyclopenta-2,5-dien-3-yl)pyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl (2S)-2-(1λ3-ioda-2,4-diazacyclopenta-2,5-dien-3-yl)pyrrolidine-1-carboxylate (CID 142722129) is tert-butyl (2S)-2-(1λ3-ioda-2,4-diazacyclopenta-2,5-dien-3-yl)pyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl (2S)-2-(1λ3-ioda-2,4-diazacyclopenta-2,5-dien-3-yl)pyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl (2S)-2-(1λ3-ioda-2,4-diazacyclopenta-2,5-dien-3-yl)pyrrolidine-1-carboxylate is CC(C)(C)OC(=O)N1CCC[C@H]1C1=NI=CN1.
What is the InChIKey of tert-butyl (2S)-2-(1λ3-ioda-2,4-diazacyclopenta-2,5-dien-3-yl)pyrrolidine-1-carboxylate?
The InChIKey is QQNSLJULOPRVJF-QMMMGPOBSA-N. The full InChI is InChI=1S/C11H18IN3O2/c1-11(2,3)17-10(16)15-6-4-5-8(15)9-13-7-12-14-9/h7-8H,4-6H2,1-3H3,(H,13,14)/t8-/m0/s1.
What are the key properties of tert-butyl (2S)-2-(1λ3-ioda-2,4-diazacyclopenta-2,5-dien-3-yl)pyrrolidine-1-carboxylate?
tert-butyl (2S)-2-(1λ3-ioda-2,4-diazacyclopenta-2,5-dien-3-yl)pyrrolidine-1-carboxylate has a molecular weight of 351.19 g/mol, XLogP of 2.03, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S)-2-(1λ3-ioda-2,4-diazacyclopenta-2,5-dien-3-yl)pyrrolidine-1-carboxylate is sourced from PubChem (CID 142722129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).