About (3S,4S)-4-(5-fluoro-6-methyl-2-pyridinyl)piperidine-3,4-diol
(3S,4S)-4-(5-fluoro-6-methyl-2-pyridinyl)piperidine-3,4-diol (PubChem CID 142722521) has the molecular formula C11H15FN2O2
and a molecular weight of 226.25 g/mol. Its IUPAC name is (3S,4S)-4-(5-fluoro-6-methyl-2-pyridinyl)piperidine-3,4-diol.
Molecular Properties
| Compound Name | (3S,4S)-4-(5-fluoro-6-methyl-2-pyridinyl)piperidine-3,4-diol |
| PubChem CID | 142722521 |
| Molecular Formula | C11H15FN2O2 |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | (3S,4S)-4-(5-fluoro-6-methyl-2-pyridinyl)piperidine-3,4-diol |
| SMILES | Cc1nc([C@@]2(O)CCNC[C@@H]2O)ccc1F |
| InChI | InChI=1S/C11H15FN2O2/c1-7-8(12)2-3-9(14-7)11(16)4-5-13-6-10(11)15/h2-3,10,13,15-16H,4-6H2,1H3/t10-,11-/m0/s1 |
| InChIKey | YIBMWLDUMHNMGZ-QWRGUYRKSA-N |
| XLogP | 0.07 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S,4S)-4-(5-fluoro-6-methyl-2-pyridinyl)piperidine-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-4-(5-fluoro-6-methyl-2-pyridinyl)piperidine-3,4-diol?
The IUPAC name of (3S,4S)-4-(5-fluoro-6-methyl-2-pyridinyl)piperidine-3,4-diol (CID 142722521) is (3S,4S)-4-(5-fluoro-6-methyl-2-pyridinyl)piperidine-3,4-diol.
What is the SMILES notation for (3S,4S)-4-(5-fluoro-6-methyl-2-pyridinyl)piperidine-3,4-diol?
The canonical SMILES for (3S,4S)-4-(5-fluoro-6-methyl-2-pyridinyl)piperidine-3,4-diol is Cc1nc([C@@]2(O)CCNC[C@@H]2O)ccc1F.
What is the InChIKey of (3S,4S)-4-(5-fluoro-6-methyl-2-pyridinyl)piperidine-3,4-diol?
The InChIKey is YIBMWLDUMHNMGZ-QWRGUYRKSA-N. The full InChI is InChI=1S/C11H15FN2O2/c1-7-8(12)2-3-9(14-7)11(16)4-5-13-6-10(11)15/h2-3,10,13,15-16H,4-6H2,1H3/t10-,11-/m0/s1.
What are the key properties of (3S,4S)-4-(5-fluoro-6-methyl-2-pyridinyl)piperidine-3,4-diol?
(3S,4S)-4-(5-fluoro-6-methyl-2-pyridinyl)piperidine-3,4-diol has a molecular weight of 226.25 g/mol, XLogP of 0.07, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-4-(5-fluoro-6-methyl-2-pyridinyl)piperidine-3,4-diol is sourced from PubChem (CID 142722521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).