About diethyl 2-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]propanedioate
diethyl 2-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]propanedioate (PubChem CID 14272263) has the molecular formula C14H24O6
and a molecular weight of 288.34 g/mol. Its IUPAC name is diethyl 2-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]propanedioate.
Molecular Properties
| Compound Name | diethyl 2-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]propanedioate |
| PubChem CID | 14272263 |
| Molecular Formula | C14H24O6 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | diethyl 2-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]propanedioate |
| SMILES | CCOC(=O)C(CCCC1(C)OCCO1)C(=O)OCC |
| InChI | InChI=1S/C14H24O6/c1-4-17-12(15)11(13(16)18-5-2)7-6-8-14(3)19-9-10-20-14/h11H,4-10H2,1-3H3 |
| InChIKey | LFDYJVUHUFQXDL-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]propanedioate?
The IUPAC name of diethyl 2-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]propanedioate (CID 14272263) is diethyl 2-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]propanedioate.
What is the SMILES notation for diethyl 2-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]propanedioate?
The canonical SMILES for diethyl 2-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]propanedioate is CCOC(=O)C(CCCC1(C)OCCO1)C(=O)OCC.
What is the InChIKey of diethyl 2-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]propanedioate?
The InChIKey is LFDYJVUHUFQXDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O6/c1-4-17-12(15)11(13(16)18-5-2)7-6-8-14(3)19-9-10-20-14/h11H,4-10H2,1-3H3.
What are the key properties of diethyl 2-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]propanedioate?
diethyl 2-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]propanedioate has a molecular weight of 288.34 g/mol, XLogP of 1.66, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]propanedioate is sourced from PubChem (CID 14272263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).