C22H20Cl6N4O4S2 — CID 142722663
2-hydroxyimino-N-[2-[2-[[2-hydroxyimino-3-(2,3,5-trichlorophenyl)propanoyl]amino]ethyldisulfanyl]ethyl]-3-(2,3,5-trichlorophenyl)propanamide (PubChem CID 142722663) has the molecular formula C22H20Cl6N4O4S2 and a molecular weight of 681.28 g/mol. Its IUPAC name is 2-hydroxyimino-N-[2-[2-[[2-hydroxyimino-3-(2,3,5-trichlorophenyl)propanoyl]amino]ethyldisulfanyl]ethyl]-3-(2,3,5-trichlorophenyl)propanamide.
| Compound Name | 2-hydroxyimino-N-[2-[2-[[2-hydroxyimino-3-(2,3,5-trichlorophenyl)propanoyl]amino]ethyldisulfanyl]ethyl]-3-(2,3,5-trichlorophenyl)propanamide |
|---|---|
| PubChem CID | 142722663 |
| Molecular Formula | C22H20Cl6N4O4S2 |
| Molecular Weight | 681.28 g/mol |
| Exact Mass | 677.91 |
| IUPAC Name | 2-hydroxyimino-N-[2-[2-[[2-hydroxyimino-3-(2,3,5-trichlorophenyl)propanoyl]amino]ethyldisulfanyl]ethyl]-3-(2,3,5-trichlorophenyl)propanamide |
| SMILES | O=C(NCCSSCCNC(=O)C(Cc1cc(Cl)cc(Cl)c1Cl)=NO)C(Cc1cc(Cl)cc(Cl)c1Cl)=NO |
| InChI | InChI=1S/C22H20Cl6N4O4S2/c23-13-5-11(19(27)15(25)9-13)7-17(31-35)21(33)29-1-3-37-38-4-2-30-22(34)18(32-36)8-12-6-14(24)10-16(26)20(12)28/h5-6,9-10,35-36H,1-4,7-8H2,(H,29,33)(H,30,34) |
| InChIKey | KWXLVKYFXPBRJO-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.28 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|