C24H28BClFN3O3 — CID 142722676
2-[2-(3-chloro-4-fluorophenyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridin-3-yl]-N-propan-2-ylacetamide (PubChem CID 142722676) has the molecular formula C24H28BClFN3O3 and a molecular weight of 471.77 g/mol. Its IUPAC name is 2-[2-(3-chloro-4-fluorophenyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridin-3-yl]-N-propan-2-ylacetamide.
| Compound Name | 2-[2-(3-chloro-4-fluorophenyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridin-3-yl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 142722676 |
| Molecular Formula | C24H28BClFN3O3 |
| Molecular Weight | 471.77 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 2-[2-(3-chloro-4-fluorophenyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridin-3-yl]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)Cc1c(-c2ccc(F)c(Cl)c2)nc2cc(B3OC(C)(C)C(C)(C)O3)ccn12 |
| InChI | InChI=1S/C24H28BClFN3O3/c1-14(2)28-21(31)13-19-22(15-7-8-18(27)17(26)11-15)29-20-12-16(9-10-30(19)20)25-32-23(3,4)24(5,6)33-25/h7-12,14H,13H2,1-6H3,(H,28,31) |
| InChIKey | XXVLSWVYLWVNFM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.77 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|