C16H10BrNO — CID 142722872
4-(4-bromophenyl)furo[2,3-b]indole (PubChem CID 142722872) has the molecular formula C16H10BrNO and a molecular weight of 312.17 g/mol. Its IUPAC name is 4-(4-bromophenyl)furo[2,3-b]indole.
| Compound Name | 4-(4-bromophenyl)furo[2,3-b]indole |
|---|---|
| PubChem CID | 142722872 |
| Molecular Formula | C16H10BrNO |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 310.99 |
| IUPAC Name | 4-(4-bromophenyl)furo[2,3-b]indole |
| SMILES | Brc1ccc(-n2c3ccccc3c3ccoc32)cc1 |
| InChI | InChI=1S/C16H10BrNO/c17-11-5-7-12(8-6-11)18-15-4-2-1-3-13(15)14-9-10-19-16(14)18/h1-10H |
| InChIKey | DFJALFPEIXJJBB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 18.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |