C6H8O6Si — CID 142722982
[dicarboxy(prop-2-enyl)silyl]formic acid (PubChem CID 142722982) has the molecular formula C6H8O6Si and a molecular weight of 204.21 g/mol. Its IUPAC name is [dicarboxy(prop-2-enyl)silyl]formic acid.
| Compound Name | [dicarboxy(prop-2-enyl)silyl]formic acid |
|---|---|
| PubChem CID | 142722982 |
| Molecular Formula | C6H8O6Si |
| Molecular Weight | 204.21 g/mol |
| Exact Mass | 204.01 |
| IUPAC Name | [dicarboxy(prop-2-enyl)silyl]formic acid |
| SMILES | C=CC[Si](C(=O)O)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C6H8O6Si/c1-2-3-13(4(7)8,5(9)10)6(11)12/h2H,1,3H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | CCHASXOWFKLRCI-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|