About (2E)-N-(3-aminocyclohexyl)-N-[(2E)-penta-2,4-dienoyl]penta-2,4-dienamide
(2E)-N-(3-aminocyclohexyl)-N-[(2E)-penta-2,4-dienoyl]penta-2,4-dienamide (PubChem CID 142723117) has the molecular formula C16H22N2O2
and a molecular weight of 274.36 g/mol. Its IUPAC name is (2E)-N-(3-aminocyclohexyl)-N-[(2E)-penta-2,4-dienoyl]penta-2,4-dienamide.
Molecular Properties
| Compound Name | (2E)-N-(3-aminocyclohexyl)-N-[(2E)-penta-2,4-dienoyl]penta-2,4-dienamide |
| PubChem CID | 142723117 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | (2E)-N-(3-aminocyclohexyl)-N-[(2E)-penta-2,4-dienoyl]penta-2,4-dienamide |
| SMILES | C=C/C=C/C(=O)N(C(=O)/C=C/C=C)C1CCCC(N)C1 |
| InChI | InChI=1S/C16H22N2O2/c1-3-5-10-15(19)18(16(20)11-6-4-2)14-9-7-8-13(17)12-14/h3-6,10-11,13-14H,1-2,7-9,12,17H2/b10-5+,11-6+ |
| InChIKey | FCXASSSWZDWOOE-YOYBCKCWSA-N |
| XLogP | 2.10 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-N-(3-aminocyclohexyl)-N-[(2E)-penta-2,4-dienoyl]penta-2,4-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-N-(3-aminocyclohexyl)-N-[(2E)-penta-2,4-dienoyl]penta-2,4-dienamide?
The IUPAC name of (2E)-N-(3-aminocyclohexyl)-N-[(2E)-penta-2,4-dienoyl]penta-2,4-dienamide (CID 142723117) is (2E)-N-(3-aminocyclohexyl)-N-[(2E)-penta-2,4-dienoyl]penta-2,4-dienamide.
What is the SMILES notation for (2E)-N-(3-aminocyclohexyl)-N-[(2E)-penta-2,4-dienoyl]penta-2,4-dienamide?
The canonical SMILES for (2E)-N-(3-aminocyclohexyl)-N-[(2E)-penta-2,4-dienoyl]penta-2,4-dienamide is C=C/C=C/C(=O)N(C(=O)/C=C/C=C)C1CCCC(N)C1.
What is the InChIKey of (2E)-N-(3-aminocyclohexyl)-N-[(2E)-penta-2,4-dienoyl]penta-2,4-dienamide?
The InChIKey is FCXASSSWZDWOOE-YOYBCKCWSA-N. The full InChI is InChI=1S/C16H22N2O2/c1-3-5-10-15(19)18(16(20)11-6-4-2)14-9-7-8-13(17)12-14/h3-6,10-11,13-14H,1-2,7-9,12,17H2/b10-5+,11-6+.
What are the key properties of (2E)-N-(3-aminocyclohexyl)-N-[(2E)-penta-2,4-dienoyl]penta-2,4-dienamide?
(2E)-N-(3-aminocyclohexyl)-N-[(2E)-penta-2,4-dienoyl]penta-2,4-dienamide has a molecular weight of 274.36 g/mol, XLogP of 2.10, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-N-(3-aminocyclohexyl)-N-[(2E)-penta-2,4-dienoyl]penta-2,4-dienamide is sourced from PubChem (CID 142723117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).