About methyl (2R)-2-ethoxy-3-[3-[5-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]phenyl]propanoate
methyl (2R)-2-ethoxy-3-[3-[5-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]phenyl]propanoate (PubChem CID 142723643) has the molecular formula C21H22FNO4
and a molecular weight of 371.41 g/mol. Its IUPAC name is methyl (2R)-2-ethoxy-3-[3-[5-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]phenyl]propanoate.
Molecular Properties
| Compound Name | methyl (2R)-2-ethoxy-3-[3-[5-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]phenyl]propanoate |
| PubChem CID | 142723643 |
| Molecular Formula | C21H22FNO4 |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | methyl (2R)-2-ethoxy-3-[3-[5-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]phenyl]propanoate |
| SMILES | CCO[C@H](Cc1cccc(C2=NOC(c3ccc(F)cc3)C2)c1)C(=O)OC |
| InChI | InChI=1S/C21H22FNO4/c1-3-26-20(21(24)25-2)12-14-5-4-6-16(11-14)18-13-19(27-23-18)15-7-9-17(22)10-8-15/h4-11,19-20H,3,12-13H2,1-2H3/t19?,20-/m1/s1 |
| InChIKey | SWZNLYTVAZVDAZ-GFOWMXPYSA-N |
| XLogP | 3.81 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl (2R)-2-ethoxy-3-[3-[5-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]phenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-2-ethoxy-3-[3-[5-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]phenyl]propanoate?
The IUPAC name of methyl (2R)-2-ethoxy-3-[3-[5-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]phenyl]propanoate (CID 142723643) is methyl (2R)-2-ethoxy-3-[3-[5-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]phenyl]propanoate.
What is the SMILES notation for methyl (2R)-2-ethoxy-3-[3-[5-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]phenyl]propanoate?
The canonical SMILES for methyl (2R)-2-ethoxy-3-[3-[5-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]phenyl]propanoate is CCO[C@H](Cc1cccc(C2=NOC(c3ccc(F)cc3)C2)c1)C(=O)OC.
What is the InChIKey of methyl (2R)-2-ethoxy-3-[3-[5-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]phenyl]propanoate?
The InChIKey is SWZNLYTVAZVDAZ-GFOWMXPYSA-N. The full InChI is InChI=1S/C21H22FNO4/c1-3-26-20(21(24)25-2)12-14-5-4-6-16(11-14)18-13-19(27-23-18)15-7-9-17(22)10-8-15/h4-11,19-20H,3,12-13H2,1-2H3/t19?,20-/m1/s1.
What are the key properties of methyl (2R)-2-ethoxy-3-[3-[5-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]phenyl]propanoate?
methyl (2R)-2-ethoxy-3-[3-[5-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]phenyl]propanoate has a molecular weight of 371.41 g/mol, XLogP of 3.81, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-ethoxy-3-[3-[5-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]phenyl]propanoate is sourced from PubChem (CID 142723643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).