C22H13Cl2FN2O — CID 142723975
N-[2-(3,5-dichlorophenyl)-4-fluorophenyl]quinoline-5-carboxamide (PubChem CID 142723975) has the molecular formula C22H13Cl2FN2O and a molecular weight of 411.26 g/mol. Its IUPAC name is N-[2-(3,5-dichlorophenyl)-4-fluorophenyl]quinoline-5-carboxamide.
| Compound Name | N-[2-(3,5-dichlorophenyl)-4-fluorophenyl]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 142723975 |
| Molecular Formula | C22H13Cl2FN2O |
| Molecular Weight | 411.26 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | N-[2-(3,5-dichlorophenyl)-4-fluorophenyl]quinoline-5-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1-c1cc(Cl)cc(Cl)c1)c1cccc2ncccc12 |
| InChI | InChI=1S/C22H13Cl2FN2O/c23-14-9-13(10-15(24)11-14)19-12-16(25)6-7-21(19)27-22(28)18-3-1-5-20-17(18)4-2-8-26-20/h1-12H,(H,27,28) |
| InChIKey | GWQHJYWTIHOAPR-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.26 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |