C18H10N4O4 — CID 142724120
3-methyl-10-nitro-5,12-dioxo-6H-isoquinolino[2,3-a]quinazoline-7-carbonitrile (PubChem CID 142724120) has the molecular formula C18H10N4O4 and a molecular weight of 346.30 g/mol. Its IUPAC name is 3-methyl-10-nitro-5,12-dioxo-6H-isoquinolino[2,3-a]quinazoline-7-carbonitrile.
| Compound Name | 3-methyl-10-nitro-5,12-dioxo-6H-isoquinolino[2,3-a]quinazoline-7-carbonitrile |
|---|---|
| PubChem CID | 142724120 |
| Molecular Formula | C18H10N4O4 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 3-methyl-10-nitro-5,12-dioxo-6H-isoquinolino[2,3-a]quinazoline-7-carbonitrile |
| SMILES | Cc1ccc2c(c1)c(=O)[nH]c1c(C#N)c3ccc([N+](=O)[O-])cc3c(=O)n12 |
| InChI | InChI=1S/C18H10N4O4/c1-9-2-5-15-13(6-9)17(23)20-16-14(8-19)11-4-3-10(22(25)26)7-12(11)18(24)21(15)16/h2-7H,1H3,(H,20,23) |
| InChIKey | NNEPBIRBRWWKHH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 121.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|