C28H27BN2O2 — CID 142724457
1-[3-indol-1-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]indole (PubChem CID 142724457) has the molecular formula C28H27BN2O2 and a molecular weight of 434.35 g/mol. Its IUPAC name is 1-[3-indol-1-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]indole.
| Compound Name | 1-[3-indol-1-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]indole |
|---|---|
| PubChem CID | 142724457 |
| Molecular Formula | C28H27BN2O2 |
| Molecular Weight | 434.35 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 1-[3-indol-1-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]indole |
| SMILES | CC1(C)OB(c2cc(-n3ccc4ccccc43)cc(-n3ccc4ccccc43)c2)OC1(C)C |
| InChI | InChI=1S/C28H27BN2O2/c1-27(2)28(3,4)33-29(32-27)22-17-23(30-15-13-20-9-5-7-11-25(20)30)19-24(18-22)31-16-14-21-10-6-8-12-26(21)31/h5-19H,1-4H3 |
| InChIKey | NHYLDYMSBGRZRI-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 28.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.35 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|