C14H28O2 — CID 142724775
1,3-bis(2-methylpropoxy)cyclohexane (PubChem CID 142724775) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is 1,3-bis(2-methylpropoxy)cyclohexane.
| Compound Name | 1,3-bis(2-methylpropoxy)cyclohexane |
|---|---|
| PubChem CID | 142724775 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | 1,3-bis(2-methylpropoxy)cyclohexane |
| SMILES | CC(C)COC1CCCC(OCC(C)C)C1 |
| InChI | InChI=1S/C14H28O2/c1-11(2)9-15-13-6-5-7-14(8-13)16-10-12(3)4/h11-14H,5-10H2,1-4H3 |
| InChIKey | WLONSPHVLPQBBG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |