C23H25FN2OS — CID 142725182
4-(4-fluorophenyl)-N-methyl-N-(2-piperidin-1-ylethyl)-1-benzothiophene-2-carboxamide (PubChem CID 142725182) has the molecular formula C23H25FN2OS and a molecular weight of 396.53 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-methyl-N-(2-piperidin-1-ylethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 4-(4-fluorophenyl)-N-methyl-N-(2-piperidin-1-ylethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 142725182 |
| Molecular Formula | C23H25FN2OS |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 4-(4-fluorophenyl)-N-methyl-N-(2-piperidin-1-ylethyl)-1-benzothiophene-2-carboxamide |
| SMILES | CN(CCN1CCCCC1)C(=O)c1cc2c(-c3ccc(F)cc3)cccc2s1 |
| InChI | InChI=1S/C23H25FN2OS/c1-25(14-15-26-12-3-2-4-13-26)23(27)22-16-20-19(6-5-7-21(20)28-22)17-8-10-18(24)11-9-17/h5-11,16H,2-4,12-15H2,1H3 |
| InChIKey | SVIZZLBSQHNHTD-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |