C24H15N3O2 — CID 142725706
10-(2-nitrophenyl)-1,13-diazapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),10,12,14,16,18-nonaene (PubChem CID 142725706) has the molecular formula C24H15N3O2 and a molecular weight of 377.40 g/mol. Its IUPAC name is 10-(2-nitrophenyl)-1,13-diazapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),10,12,14,16,18-nonaene.
| Compound Name | 10-(2-nitrophenyl)-1,13-diazapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),10,12,14,16,18-nonaene |
|---|---|
| PubChem CID | 142725706 |
| Molecular Formula | C24H15N3O2 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 10-(2-nitrophenyl)-1,13-diazapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),10,12,14,16,18-nonaene |
| SMILES | O=[N+]([O-])c1ccccc1C1=Cc2nc3ccccc3n3c2c(c2ccccc23)C1 |
| InChI | InChI=1S/C24H15N3O2/c28-27(29)22-11-5-1-7-16(22)15-13-18-17-8-2-4-10-21(17)26-23-12-6-3-9-19(23)25-20(14-15)24(18)26/h1-12,14H,13H2 |
| InChIKey | SAAMNMBSDYVRJR-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|