C12H16O7 — CID 14272617
[(3aS,5S,6R,7aR)-5-acetyloxy-2-oxo-3,3a,4,5,6,7a-hexahydrofuro[2,3-b]pyran-6-yl]methyl acetate (PubChem CID 14272617) has the molecular formula C12H16O7 and a molecular weight of 272.25 g/mol. Its IUPAC name is [(3aS,5S,6R,7aR)-5-acetyloxy-2-oxo-3,3a,4,5,6,7a-hexahydrofuro[2,3-b]pyran-6-yl]methyl acetate.
| Compound Name | [(3aS,5S,6R,7aR)-5-acetyloxy-2-oxo-3,3a,4,5,6,7a-hexahydrofuro[2,3-b]pyran-6-yl]methyl acetate |
|---|---|
| PubChem CID | 14272617 |
| Molecular Formula | C12H16O7 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | [(3aS,5S,6R,7aR)-5-acetyloxy-2-oxo-3,3a,4,5,6,7a-hexahydrofuro[2,3-b]pyran-6-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H]2OC(=O)C[C@@H]2C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C12H16O7/c1-6(13)16-5-10-9(17-7(2)14)3-8-4-11(15)19-12(8)18-10/h8-10,12H,3-5H2,1-2H3/t8-,9-,10+,12+/m0/s1 |
| InChIKey | QSBMFXTVFLSSJS-UXCLJVHYSA-N |
| XLogP | 0.16 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|