About 4-chloro-1-hydroxybutane-1,2,3-tricarbonitrile
4-chloro-1-hydroxybutane-1,2,3-tricarbonitrile (PubChem CID 142726914) has the molecular formula C7H6ClN3O
and a molecular weight of 183.60 g/mol. Its IUPAC name is 4-chloro-1-hydroxybutane-1,2,3-tricarbonitrile.
Molecular Properties
| Compound Name | 4-chloro-1-hydroxybutane-1,2,3-tricarbonitrile |
| PubChem CID | 142726914 |
| Molecular Formula | C7H6ClN3O |
| Molecular Weight | 183.60 g/mol |
| Exact Mass | 183.02 |
| IUPAC Name | 4-chloro-1-hydroxybutane-1,2,3-tricarbonitrile |
| SMILES | N#CC(O)C(C#N)C(C#N)CCl |
| InChI | InChI=1S/C7H6ClN3O/c8-1-5(2-9)6(3-10)7(12)4-11/h5-7,12H,1H2 |
| InChIKey | QMSZGZVEQLTPKM-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 91.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.60 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-1-hydroxybutane-1,2,3-tricarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1-hydroxybutane-1,2,3-tricarbonitrile?
The IUPAC name of 4-chloro-1-hydroxybutane-1,2,3-tricarbonitrile (CID 142726914) is 4-chloro-1-hydroxybutane-1,2,3-tricarbonitrile.
What is the SMILES notation for 4-chloro-1-hydroxybutane-1,2,3-tricarbonitrile?
The canonical SMILES for 4-chloro-1-hydroxybutane-1,2,3-tricarbonitrile is N#CC(O)C(C#N)C(C#N)CCl.
What is the InChIKey of 4-chloro-1-hydroxybutane-1,2,3-tricarbonitrile?
The InChIKey is QMSZGZVEQLTPKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClN3O/c8-1-5(2-9)6(3-10)7(12)4-11/h5-7,12H,1H2.
What are the key properties of 4-chloro-1-hydroxybutane-1,2,3-tricarbonitrile?
4-chloro-1-hydroxybutane-1,2,3-tricarbonitrile has a molecular weight of 183.60 g/mol, XLogP of 0.39, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1-hydroxybutane-1,2,3-tricarbonitrile is sourced from PubChem (CID 142726914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).