C17H13F3N2O2S — CID 142727009
4-[2-[[3-(trifluoromethyl)phenyl]methylamino]-1,3-thiazol-4-yl]benzene-1,2-diol (PubChem CID 142727009) has the molecular formula C17H13F3N2O2S and a molecular weight of 366.36 g/mol. Its IUPAC name is 4-[2-[[3-(trifluoromethyl)phenyl]methylamino]-1,3-thiazol-4-yl]benzene-1,2-diol.
| Compound Name | 4-[2-[[3-(trifluoromethyl)phenyl]methylamino]-1,3-thiazol-4-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 142727009 |
| Molecular Formula | C17H13F3N2O2S |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 4-[2-[[3-(trifluoromethyl)phenyl]methylamino]-1,3-thiazol-4-yl]benzene-1,2-diol |
| SMILES | Oc1ccc(-c2csc(NCc3cccc(C(F)(F)F)c3)n2)cc1O |
| InChI | InChI=1S/C17H13F3N2O2S/c18-17(19,20)12-3-1-2-10(6-12)8-21-16-22-13(9-25-16)11-4-5-14(23)15(24)7-11/h1-7,9,23-24H,8H2,(H,21,22) |
| InChIKey | YDWMWNPVCLZBPH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|