About 4-[2-[[2-(trifluoromethyl)phenyl]methylamino]-1,3-thiazol-4-yl]benzene-1,2-diol
4-[2-[[2-(trifluoromethyl)phenyl]methylamino]-1,3-thiazol-4-yl]benzene-1,2-diol (PubChem CID 142727013) has the molecular formula C17H13F3N2O2S
and a molecular weight of 366.36 g/mol. Its IUPAC name is 4-[2-[[2-(trifluoromethyl)phenyl]methylamino]-1,3-thiazol-4-yl]benzene-1,2-diol.
Molecular Properties
| Compound Name | 4-[2-[[2-(trifluoromethyl)phenyl]methylamino]-1,3-thiazol-4-yl]benzene-1,2-diol |
| PubChem CID | 142727013 |
| Molecular Formula | C17H13F3N2O2S |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 4-[2-[[2-(trifluoromethyl)phenyl]methylamino]-1,3-thiazol-4-yl]benzene-1,2-diol |
| SMILES | Oc1ccc(-c2csc(NCc3ccccc3C(F)(F)F)n2)cc1O |
| InChI | InChI=1S/C17H13F3N2O2S/c18-17(19,20)12-4-2-1-3-11(12)8-21-16-22-13(9-25-16)10-5-6-14(23)15(24)7-10/h1-7,9,23-24H,8H2,(H,21,22) |
| InChIKey | VOHSBXNTRXVMEE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[[2-(trifluoromethyl)phenyl]methylamino]-1,3-thiazol-4-yl]benzene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[[2-(trifluoromethyl)phenyl]methylamino]-1,3-thiazol-4-yl]benzene-1,2-diol?
The IUPAC name of 4-[2-[[2-(trifluoromethyl)phenyl]methylamino]-1,3-thiazol-4-yl]benzene-1,2-diol (CID 142727013) is 4-[2-[[2-(trifluoromethyl)phenyl]methylamino]-1,3-thiazol-4-yl]benzene-1,2-diol.
What is the SMILES notation for 4-[2-[[2-(trifluoromethyl)phenyl]methylamino]-1,3-thiazol-4-yl]benzene-1,2-diol?
The canonical SMILES for 4-[2-[[2-(trifluoromethyl)phenyl]methylamino]-1,3-thiazol-4-yl]benzene-1,2-diol is Oc1ccc(-c2csc(NCc3ccccc3C(F)(F)F)n2)cc1O.
What is the InChIKey of 4-[2-[[2-(trifluoromethyl)phenyl]methylamino]-1,3-thiazol-4-yl]benzene-1,2-diol?
The InChIKey is VOHSBXNTRXVMEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13F3N2O2S/c18-17(19,20)12-4-2-1-3-11(12)8-21-16-22-13(9-25-16)10-5-6-14(23)15(24)7-10/h1-7,9,23-24H,8H2,(H,21,22).
What are the key properties of 4-[2-[[2-(trifluoromethyl)phenyl]methylamino]-1,3-thiazol-4-yl]benzene-1,2-diol?
4-[2-[[2-(trifluoromethyl)phenyl]methylamino]-1,3-thiazol-4-yl]benzene-1,2-diol has a molecular weight of 366.36 g/mol, XLogP of 4.85, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[[2-(trifluoromethyl)phenyl]methylamino]-1,3-thiazol-4-yl]benzene-1,2-diol is sourced from PubChem (CID 142727013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).