About 2-methoxy-N-[3-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl]benzamide
2-methoxy-N-[3-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl]benzamide (PubChem CID 142727292) has the molecular formula C26H23NO7
and a molecular weight of 461.47 g/mol. Its IUPAC name is 2-methoxy-N-[3-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl]benzamide.
Molecular Properties
| Compound Name | 2-methoxy-N-[3-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl]benzamide |
| PubChem CID | 142727292 |
| Molecular Formula | C26H23NO7 |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 2-methoxy-N-[3-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl]benzamide |
| SMILES | COc1ccccc1C(=O)Nc1cccc(-c2cc(=O)c3c(OC)c(OC)c(OC)cc3o2)c1 |
| InChI | InChI=1S/C26H23NO7/c1-30-19-11-6-5-10-17(19)26(29)27-16-9-7-8-15(12-16)20-13-18(28)23-21(34-20)14-22(31-2)24(32-3)25(23)33-4/h5-14H,1-4H3,(H,27,29) |
| InChIKey | QAJFOSAFQKPWLL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-methoxy-N-[3-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-N-[3-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl]benzamide?
The IUPAC name of 2-methoxy-N-[3-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl]benzamide (CID 142727292) is 2-methoxy-N-[3-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl]benzamide.
What is the SMILES notation for 2-methoxy-N-[3-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl]benzamide?
The canonical SMILES for 2-methoxy-N-[3-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl]benzamide is COc1ccccc1C(=O)Nc1cccc(-c2cc(=O)c3c(OC)c(OC)c(OC)cc3o2)c1.
What is the InChIKey of 2-methoxy-N-[3-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl]benzamide?
The InChIKey is QAJFOSAFQKPWLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H23NO7/c1-30-19-11-6-5-10-17(19)26(29)27-16-9-7-8-15(12-16)20-13-18(28)23-21(34-20)14-22(31-2)24(32-3)25(23)33-4/h5-14H,1-4H3,(H,27,29).
What are the key properties of 2-methoxy-N-[3-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl]benzamide?
2-methoxy-N-[3-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl]benzamide has a molecular weight of 461.47 g/mol, XLogP of 4.75, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-N-[3-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl]benzamide is sourced from PubChem (CID 142727292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).