About 4-nitro-N-[4-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl]benzamide
4-nitro-N-[4-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl]benzamide (PubChem CID 142727294) has the molecular formula C25H20N2O8
and a molecular weight of 476.44 g/mol. Its IUPAC name is 4-nitro-N-[4-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl]benzamide.
Molecular Properties
| Compound Name | 4-nitro-N-[4-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl]benzamide |
| PubChem CID | 142727294 |
| Molecular Formula | C25H20N2O8 |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 4-nitro-N-[4-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl]benzamide |
| SMILES | COc1cc2oc(-c3ccc(NC(=O)c4ccc([N+](=O)[O-])cc4)cc3)cc(=O)c2c(OC)c1OC |
| InChI | InChI=1S/C25H20N2O8/c1-32-21-13-20-22(24(34-3)23(21)33-2)18(28)12-19(35-20)14-4-8-16(9-5-14)26-25(29)15-6-10-17(11-7-15)27(30)31/h4-13H,1-3H3,(H,26,29) |
| InChIKey | JAHHEMMLRUIDPY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 130.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitro-N-[4-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitro-N-[4-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl]benzamide?
The IUPAC name of 4-nitro-N-[4-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl]benzamide (CID 142727294) is 4-nitro-N-[4-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl]benzamide.
What is the SMILES notation for 4-nitro-N-[4-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl]benzamide?
The canonical SMILES for 4-nitro-N-[4-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl]benzamide is COc1cc2oc(-c3ccc(NC(=O)c4ccc([N+](=O)[O-])cc4)cc3)cc(=O)c2c(OC)c1OC.
What is the InChIKey of 4-nitro-N-[4-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl]benzamide?
The InChIKey is JAHHEMMLRUIDPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20N2O8/c1-32-21-13-20-22(24(34-3)23(21)33-2)18(28)12-19(35-20)14-4-8-16(9-5-14)26-25(29)15-6-10-17(11-7-15)27(30)31/h4-13H,1-3H3,(H,26,29).
What are the key properties of 4-nitro-N-[4-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl]benzamide?
4-nitro-N-[4-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl]benzamide has a molecular weight of 476.44 g/mol, XLogP of 4.65, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitro-N-[4-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl]benzamide is sourced from PubChem (CID 142727294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).