C17H17BrO4 — CID 142728271
2-(5-bromo-2,4-dimethoxyphenyl)-1-(4-methoxyphenyl)ethanone (PubChem CID 142728271) has the molecular formula C17H17BrO4 and a molecular weight of 365.22 g/mol. Its IUPAC name is 2-(5-bromo-2,4-dimethoxyphenyl)-1-(4-methoxyphenyl)ethanone.
| Compound Name | 2-(5-bromo-2,4-dimethoxyphenyl)-1-(4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 142728271 |
| Molecular Formula | C17H17BrO4 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | 2-(5-bromo-2,4-dimethoxyphenyl)-1-(4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)Cc2cc(Br)c(OC)cc2OC)cc1 |
| InChI | InChI=1S/C17H17BrO4/c1-20-13-6-4-11(5-7-13)15(19)9-12-8-14(18)17(22-3)10-16(12)21-2/h4-8,10H,9H2,1-3H3 |
| InChIKey | MTPHWKNRFYDWKZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |