About 3-amino-1-piperidin-4-yl-5H-pyrazolo[4,3-c]pyridin-4-one
3-amino-1-piperidin-4-yl-5H-pyrazolo[4,3-c]pyridin-4-one (PubChem CID 142728717) has the molecular formula C11H15N5O
and a molecular weight of 233.27 g/mol. Its IUPAC name is 3-amino-1-piperidin-4-yl-5H-pyrazolo[4,3-c]pyridin-4-one.
Molecular Properties
| Compound Name | 3-amino-1-piperidin-4-yl-5H-pyrazolo[4,3-c]pyridin-4-one |
| PubChem CID | 142728717 |
| Molecular Formula | C11H15N5O |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 3-amino-1-piperidin-4-yl-5H-pyrazolo[4,3-c]pyridin-4-one |
| SMILES | Nc1nn(C2CCNCC2)c2cc[nH]c(=O)c12 |
| InChI | InChI=1S/C11H15N5O/c12-10-9-8(3-6-14-11(9)17)16(15-10)7-1-4-13-5-2-7/h3,6-7,13H,1-2,4-5H2,(H2,12,15)(H,14,17) |
| InChIKey | IWPRPIDXJWTROT-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 88.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-1-piperidin-4-yl-5H-pyrazolo[4,3-c]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-piperidin-4-yl-5H-pyrazolo[4,3-c]pyridin-4-one?
The IUPAC name of 3-amino-1-piperidin-4-yl-5H-pyrazolo[4,3-c]pyridin-4-one (CID 142728717) is 3-amino-1-piperidin-4-yl-5H-pyrazolo[4,3-c]pyridin-4-one.
What is the SMILES notation for 3-amino-1-piperidin-4-yl-5H-pyrazolo[4,3-c]pyridin-4-one?
The canonical SMILES for 3-amino-1-piperidin-4-yl-5H-pyrazolo[4,3-c]pyridin-4-one is Nc1nn(C2CCNCC2)c2cc[nH]c(=O)c12.
What is the InChIKey of 3-amino-1-piperidin-4-yl-5H-pyrazolo[4,3-c]pyridin-4-one?
The InChIKey is IWPRPIDXJWTROT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N5O/c12-10-9-8(3-6-14-11(9)17)16(15-10)7-1-4-13-5-2-7/h3,6-7,13H,1-2,4-5H2,(H2,12,15)(H,14,17).
What are the key properties of 3-amino-1-piperidin-4-yl-5H-pyrazolo[4,3-c]pyridin-4-one?
3-amino-1-piperidin-4-yl-5H-pyrazolo[4,3-c]pyridin-4-one has a molecular weight of 233.27 g/mol, XLogP of 0.23, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-piperidin-4-yl-5H-pyrazolo[4,3-c]pyridin-4-one is sourced from PubChem (CID 142728717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).