C20H15ClF3N5O4 — CID 142728903
7-[(4-chlorophenyl)methyl]-1-hydroxy-3-methyl-8-[3-(trifluoromethoxy)anilino]purine-2,6-dione (PubChem CID 142728903) has the molecular formula C20H15ClF3N5O4 and a molecular weight of 481.82 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-1-hydroxy-3-methyl-8-[3-(trifluoromethoxy)anilino]purine-2,6-dione.
| Compound Name | 7-[(4-chlorophenyl)methyl]-1-hydroxy-3-methyl-8-[3-(trifluoromethoxy)anilino]purine-2,6-dione |
|---|---|
| PubChem CID | 142728903 |
| Molecular Formula | C20H15ClF3N5O4 |
| Molecular Weight | 481.82 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-1-hydroxy-3-methyl-8-[3-(trifluoromethoxy)anilino]purine-2,6-dione |
| SMILES | Cn1c(=O)n(O)c(=O)c2c1nc(Nc1cccc(OC(F)(F)F)c1)n2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H15ClF3N5O4/c1-27-16-15(17(30)29(32)19(27)31)28(10-11-5-7-12(21)8-6-11)18(26-16)25-13-3-2-4-14(9-13)33-20(22,23)24/h2-9,32H,10H2,1H3,(H,25,26) |
| InChIKey | ATCMRRKBXCEULL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 103.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.82 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|