C14H18O5S — CID 142728977
4-[(4,4-dihydroxycyclohexa-1,5-dien-1-yl)methylsulfinylmethyl]cyclohexa-2,4-diene-1,1-diol (PubChem CID 142728977) has the molecular formula C14H18O5S and a molecular weight of 298.36 g/mol. Its IUPAC name is 4-[(4,4-dihydroxycyclohexa-1,5-dien-1-yl)methylsulfinylmethyl]cyclohexa-2,4-diene-1,1-diol.
| Compound Name | 4-[(4,4-dihydroxycyclohexa-1,5-dien-1-yl)methylsulfinylmethyl]cyclohexa-2,4-diene-1,1-diol |
|---|---|
| PubChem CID | 142728977 |
| Molecular Formula | C14H18O5S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 4-[(4,4-dihydroxycyclohexa-1,5-dien-1-yl)methylsulfinylmethyl]cyclohexa-2,4-diene-1,1-diol |
| SMILES | O=S(CC1=CCC(O)(O)C=C1)CC1=CCC(O)(O)C=C1 |
| InChI | InChI=1S/C14H18O5S/c15-13(16)5-1-11(2-6-13)9-20(19)10-12-3-7-14(17,18)8-4-12/h1-5,7,15-18H,6,8-10H2 |
| InChIKey | ZIKRGFYUQBORND-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|