About 4-[(3-fluorophenyl)methoxy]benzene-1,3-diamine
4-[(3-fluorophenyl)methoxy]benzene-1,3-diamine (PubChem CID 142729114) has the molecular formula C13H13FN2O
and a molecular weight of 232.26 g/mol. Its IUPAC name is 4-[(3-fluorophenyl)methoxy]benzene-1,3-diamine.
Molecular Properties
| Compound Name | 4-[(3-fluorophenyl)methoxy]benzene-1,3-diamine |
| PubChem CID | 142729114 |
| Molecular Formula | C13H13FN2O |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 4-[(3-fluorophenyl)methoxy]benzene-1,3-diamine |
| SMILES | Nc1ccc(OCc2cccc(F)c2)c(N)c1 |
| InChI | InChI=1S/C13H13FN2O/c14-10-3-1-2-9(6-10)8-17-13-5-4-11(15)7-12(13)16/h1-7H,8,15-16H2 |
| InChIKey | HRUAZCAXLVMWOA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3-fluorophenyl)methoxy]benzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-fluorophenyl)methoxy]benzene-1,3-diamine?
The IUPAC name of 4-[(3-fluorophenyl)methoxy]benzene-1,3-diamine (CID 142729114) is 4-[(3-fluorophenyl)methoxy]benzene-1,3-diamine.
What is the SMILES notation for 4-[(3-fluorophenyl)methoxy]benzene-1,3-diamine?
The canonical SMILES for 4-[(3-fluorophenyl)methoxy]benzene-1,3-diamine is Nc1ccc(OCc2cccc(F)c2)c(N)c1.
What is the InChIKey of 4-[(3-fluorophenyl)methoxy]benzene-1,3-diamine?
The InChIKey is HRUAZCAXLVMWOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13FN2O/c14-10-3-1-2-9(6-10)8-17-13-5-4-11(15)7-12(13)16/h1-7H,8,15-16H2.
What are the key properties of 4-[(3-fluorophenyl)methoxy]benzene-1,3-diamine?
4-[(3-fluorophenyl)methoxy]benzene-1,3-diamine has a molecular weight of 232.26 g/mol, XLogP of 2.57, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-fluorophenyl)methoxy]benzene-1,3-diamine is sourced from PubChem (CID 142729114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).