About N',N'-bis[6-[tris(2-methoxyethoxy)silyl]hexyl]hexane-1,6-diamine
N',N'-bis[6-[tris(2-methoxyethoxy)silyl]hexyl]hexane-1,6-diamine (PubChem CID 142729340) has the molecular formula C36H80N2O12Si2
and a molecular weight of 789.21 g/mol. Its IUPAC name is N',N'-bis[6-[tris(2-methoxyethoxy)silyl]hexyl]hexane-1,6-diamine.
Molecular Properties
| Compound Name | N',N'-bis[6-[tris(2-methoxyethoxy)silyl]hexyl]hexane-1,6-diamine |
| PubChem CID | 142729340 |
| Molecular Formula | C36H80N2O12Si2 |
| Molecular Weight | 789.21 g/mol |
| Exact Mass | 788.52 |
| IUPAC Name | N',N'-bis[6-[tris(2-methoxyethoxy)silyl]hexyl]hexane-1,6-diamine |
| SMILES | COCCO[Si](CCCCCCN(CCCCCCN)CCCCCC[Si](OCCOC)(OCCOC)OCCOC)(OCCOC)OCCOC |
| InChI | InChI=1S/C36H80N2O12Si2/c1-39-23-29-45-51(46-30-24-40-2,47-31-25-41-3)35-17-11-9-15-21-38(20-14-8-7-13-19-37)22-16-10-12-18-36-52(48-32-26-42-4,49-33-27-43-5)50-34-28-44-6/h7-37H2,1-6H3 |
| InChIKey | LSRYCZPFHXYCAU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 140.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 52 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 789.21 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N',N'-bis[6-[tris(2-methoxyethoxy)silyl]hexyl]hexane-1,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',N'-bis[6-[tris(2-methoxyethoxy)silyl]hexyl]hexane-1,6-diamine?
The IUPAC name of N',N'-bis[6-[tris(2-methoxyethoxy)silyl]hexyl]hexane-1,6-diamine (CID 142729340) is N',N'-bis[6-[tris(2-methoxyethoxy)silyl]hexyl]hexane-1,6-diamine.
What is the SMILES notation for N',N'-bis[6-[tris(2-methoxyethoxy)silyl]hexyl]hexane-1,6-diamine?
The canonical SMILES for N',N'-bis[6-[tris(2-methoxyethoxy)silyl]hexyl]hexane-1,6-diamine is COCCO[Si](CCCCCCN(CCCCCCN)CCCCCC[Si](OCCOC)(OCCOC)OCCOC)(OCCOC)OCCOC.
What is the InChIKey of N',N'-bis[6-[tris(2-methoxyethoxy)silyl]hexyl]hexane-1,6-diamine?
The InChIKey is LSRYCZPFHXYCAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H80N2O12Si2/c1-39-23-29-45-51(46-30-24-40-2,47-31-25-41-3)35-17-11-9-15-21-38(20-14-8-7-13-19-37)22-16-10-12-18-36-52(48-32-26-42-4,49-33-27-43-5)50-34-28-44-6/h7-37H2,1-6H3.
What are the key properties of N',N'-bis[6-[tris(2-methoxyethoxy)silyl]hexyl]hexane-1,6-diamine?
N',N'-bis[6-[tris(2-methoxyethoxy)silyl]hexyl]hexane-1,6-diamine has a molecular weight of 789.21 g/mol, XLogP of 4.78, 44 rotatable bonds, 1 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for N',N'-bis[6-[tris(2-methoxyethoxy)silyl]hexyl]hexane-1,6-diamine is sourced from PubChem (CID 142729340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).